C10H17NO2S — CID 22367311
1-[(4-methyl-1,3-oxazol-2-yl)sulfanyl]hexan-2-ol (PubChem CID 22367311) has the molecular formula C10H17NO2S and a molecular weight of 215.32 g/mol. Its IUPAC name is 1-[(4-methyl-1,3-oxazol-2-yl)sulfanyl]hexan-2-ol.
| Compound Name | 1-[(4-methyl-1,3-oxazol-2-yl)sulfanyl]hexan-2-ol |
|---|---|
| PubChem CID | 22367311 |
| Molecular Formula | C10H17NO2S |
| Molecular Weight | 215.32 g/mol |
| Exact Mass | 215.10 |
| IUPAC Name | 1-[(4-methyl-1,3-oxazol-2-yl)sulfanyl]hexan-2-ol |
| SMILES | CCCCC(O)CSc1nc(C)co1 |
| InChI | InChI=1S/C10H17NO2S/c1-3-4-5-9(12)7-14-10-11-8(2)6-13-10/h6,9,12H,3-5,7H2,1-2H3 |
| InChIKey | DNEOHACTDSLIJQ-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 46.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.32 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |