C9H15NOS2 — CID 106928123
2-[(4-methyl-1,3-oxazol-2-yl)sulfanylmethyl]butane-1-thiol (PubChem CID 106928123) has the molecular formula C9H15NOS2 and a molecular weight of 217.36 g/mol. Its IUPAC name is 2-[(4-methyl-1,3-oxazol-2-yl)sulfanylmethyl]butane-1-thiol.
| Compound Name | 2-[(4-methyl-1,3-oxazol-2-yl)sulfanylmethyl]butane-1-thiol |
|---|---|
| PubChem CID | 106928123 |
| Molecular Formula | C9H15NOS2 |
| Molecular Weight | 217.36 g/mol |
| Exact Mass | 217.06 |
| IUPAC Name | 2-[(4-methyl-1,3-oxazol-2-yl)sulfanylmethyl]butane-1-thiol |
| SMILES | CCC(CS)CSc1nc(C)co1 |
| InChI | InChI=1S/C9H15NOS2/c1-3-8(5-12)6-13-9-10-7(2)4-11-9/h4,8,12H,3,5-6H2,1-2H3 |
| InChIKey | YAILQZAXUKCMCR-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 26.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.36 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|