C11H19ClN4OS — CID 67829990
N-[2-[(5-tert-butyl-1H-1,2,4-triazol-3-yl)sulfanyl]ethyl]-3-chloropropanamide (PubChem CID 67829990) has the molecular formula C11H19ClN4OS and a molecular weight of 290.82 g/mol. Its IUPAC name is N-[2-[(5-tert-butyl-1H-1,2,4-triazol-3-yl)sulfanyl]ethyl]-3-chloropropanamide.
| Compound Name | N-[2-[(5-tert-butyl-1H-1,2,4-triazol-3-yl)sulfanyl]ethyl]-3-chloropropanamide |
|---|---|
| PubChem CID | 67829990 |
| Molecular Formula | C11H19ClN4OS |
| Molecular Weight | 290.82 g/mol |
| Exact Mass | 290.10 |
| IUPAC Name | N-[2-[(5-tert-butyl-1H-1,2,4-triazol-3-yl)sulfanyl]ethyl]-3-chloropropanamide |
| SMILES | CC(C)(C)c1nc(SCCNC(=O)CCCl)n[nH]1 |
| InChI | InChI=1S/C11H19ClN4OS/c1-11(2,3)9-14-10(16-15-9)18-7-6-13-8(17)4-5-12/h4-7H2,1-3H3,(H,13,17)(H,14,15,16) |
| InChIKey | DLVWIDBDPADFBE-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.82 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|