C12H17N5OS3 — CID 91792961
2-(2-ethylsulfanyl-1,3-thiazol-4-yl)-N-[2-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanyl]ethyl]acetamide (PubChem CID 91792961) has the molecular formula C12H17N5OS3 and a molecular weight of 343.50 g/mol. Its IUPAC name is 2-(2-ethylsulfanyl-1,3-thiazol-4-yl)-N-[2-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanyl]ethyl]acetamide.
| Compound Name | 2-(2-ethylsulfanyl-1,3-thiazol-4-yl)-N-[2-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanyl]ethyl]acetamide |
|---|---|
| PubChem CID | 91792961 |
| Molecular Formula | C12H17N5OS3 |
| Molecular Weight | 343.50 g/mol |
| Exact Mass | 343.06 |
| IUPAC Name | 2-(2-ethylsulfanyl-1,3-thiazol-4-yl)-N-[2-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanyl]ethyl]acetamide |
| SMILES | CCSc1nc(CC(=O)NCCSc2n[nH]c(C)n2)cs1 |
| InChI | InChI=1S/C12H17N5OS3/c1-3-19-12-15-9(7-21-12)6-10(18)13-4-5-20-11-14-8(2)16-17-11/h7H,3-6H2,1-2H3,(H,13,18)(H,14,16,17) |
| InChIKey | BEEWUICEXSVOOK-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.50 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|