C10H12N6OS — CID 131944118
N-[2-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanyl]ethyl]pyridazine-4-carboxamide (PubChem CID 131944118) has the molecular formula C10H12N6OS and a molecular weight of 264.31 g/mol. Its IUPAC name is N-[2-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanyl]ethyl]pyridazine-4-carboxamide.
| Compound Name | N-[2-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanyl]ethyl]pyridazine-4-carboxamide |
|---|---|
| PubChem CID | 131944118 |
| Molecular Formula | C10H12N6OS |
| Molecular Weight | 264.31 g/mol |
| Exact Mass | 264.08 |
| IUPAC Name | N-[2-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanyl]ethyl]pyridazine-4-carboxamide |
| SMILES | Cc1nc(SCCNC(=O)c2ccnnc2)n[nH]1 |
| InChI | InChI=1S/C10H12N6OS/c1-7-14-10(16-15-7)18-5-4-11-9(17)8-2-3-12-13-6-8/h2-3,6H,4-5H2,1H3,(H,11,17)(H,14,15,16) |
| InChIKey | KMYJPVWGUIGTNT-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 96.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.31 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|