C16H19FN6O2S — CID 126448670
(2R)-2-(4-fluorophenyl)-N-[2-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanyl]ethyl]-3-oxopiperazine-1-carboxamide (PubChem CID 126448670) has the molecular formula C16H19FN6O2S and a molecular weight of 378.43 g/mol. Its IUPAC name is (2R)-2-(4-fluorophenyl)-N-[2-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanyl]ethyl]-3-oxopiperazine-1-carboxamide.
| Compound Name | (2R)-2-(4-fluorophenyl)-N-[2-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanyl]ethyl]-3-oxopiperazine-1-carboxamide |
|---|---|
| PubChem CID | 126448670 |
| Molecular Formula | C16H19FN6O2S |
| Molecular Weight | 378.43 g/mol |
| Exact Mass | 378.13 |
| IUPAC Name | (2R)-2-(4-fluorophenyl)-N-[2-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanyl]ethyl]-3-oxopiperazine-1-carboxamide |
| SMILES | Cc1nc(SCCNC(=O)N2CCNC(=O)[C@H]2c2ccc(F)cc2)n[nH]1 |
| InChI | InChI=1S/C16H19FN6O2S/c1-10-20-15(22-21-10)26-9-7-19-16(25)23-8-6-18-14(24)13(23)11-2-4-12(17)5-3-11/h2-5,13H,6-9H2,1H3,(H,18,24)(H,19,25)(H,20,21,22)/t13-/m1/s1 |
| InChIKey | QOJDYXZEZMMHLQ-CYBMUJFWSA-N |
| XLogP | 1.23 |
| TPSA | 103.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.43 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|