C18H22FN5O2S — CID 122560681
2-(4-fluorophenyl)-N-[2-[(5-methyl-1H-imidazol-4-yl)methylsulfanyl]ethyl]-3-oxopiperazine-1-carboxamide (PubChem CID 122560681) has the molecular formula C18H22FN5O2S and a molecular weight of 391.47 g/mol. Its IUPAC name is 2-(4-fluorophenyl)-N-[2-[(5-methyl-1H-imidazol-4-yl)methylsulfanyl]ethyl]-3-oxopiperazine-1-carboxamide.
| Compound Name | 2-(4-fluorophenyl)-N-[2-[(5-methyl-1H-imidazol-4-yl)methylsulfanyl]ethyl]-3-oxopiperazine-1-carboxamide |
|---|---|
| PubChem CID | 122560681 |
| Molecular Formula | C18H22FN5O2S |
| Molecular Weight | 391.47 g/mol |
| Exact Mass | 391.15 |
| IUPAC Name | 2-(4-fluorophenyl)-N-[2-[(5-methyl-1H-imidazol-4-yl)methylsulfanyl]ethyl]-3-oxopiperazine-1-carboxamide |
| SMILES | Cc1[nH]cnc1CSCCNC(=O)N1CCNC(=O)C1c1ccc(F)cc1 |
| InChI | InChI=1S/C18H22FN5O2S/c1-12-15(23-11-22-12)10-27-9-7-21-18(26)24-8-6-20-17(25)16(24)13-2-4-14(19)5-3-13/h2-5,11,16H,6-10H2,1H3,(H,20,25)(H,21,26)(H,22,23) |
| InChIKey | AOZCNZIUBQCDTM-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 90.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.47 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imidazole_B(2)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|