C15H24N6O3S — CID 122564417
2-[2-(methylamino)-2-oxoethyl]-N-[2-[(5-methyl-1H-imidazol-4-yl)methylsulfanyl]ethyl]-3-oxopiperazine-1-carboxamide (PubChem CID 122564417) has the molecular formula C15H24N6O3S and a molecular weight of 368.46 g/mol. Its IUPAC name is 2-[2-(methylamino)-2-oxoethyl]-N-[2-[(5-methyl-1H-imidazol-4-yl)methylsulfanyl]ethyl]-3-oxopiperazine-1-carboxamide.
| Compound Name | 2-[2-(methylamino)-2-oxoethyl]-N-[2-[(5-methyl-1H-imidazol-4-yl)methylsulfanyl]ethyl]-3-oxopiperazine-1-carboxamide |
|---|---|
| PubChem CID | 122564417 |
| Molecular Formula | C15H24N6O3S |
| Molecular Weight | 368.46 g/mol |
| Exact Mass | 368.16 |
| IUPAC Name | 2-[2-(methylamino)-2-oxoethyl]-N-[2-[(5-methyl-1H-imidazol-4-yl)methylsulfanyl]ethyl]-3-oxopiperazine-1-carboxamide |
| SMILES | CNC(=O)CC1C(=O)NCCN1C(=O)NCCSCc1nc[nH]c1C |
| InChI | InChI=1S/C15H24N6O3S/c1-10-11(20-9-19-10)8-25-6-4-18-15(24)21-5-3-17-14(23)12(21)7-13(22)16-2/h9,12H,3-8H2,1-2H3,(H,16,22)(H,17,23)(H,18,24)(H,19,20) |
| InChIKey | MXFFKPIFWRGXHB-UHFFFAOYSA-N |
| XLogP | -0.40 |
| TPSA | 119.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.46 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imidazole_B(2)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|