C12H17N3O4 — CID 116644810
2-[3-oxo-1-(pent-3-ynylcarbamoyl)piperazin-2-yl]acetic acid (PubChem CID 116644810) has the molecular formula C12H17N3O4 and a molecular weight of 267.28 g/mol. Its IUPAC name is 2-[3-oxo-1-(pent-3-ynylcarbamoyl)piperazin-2-yl]acetic acid.
| Compound Name | 2-[3-oxo-1-(pent-3-ynylcarbamoyl)piperazin-2-yl]acetic acid |
|---|---|
| PubChem CID | 116644810 |
| Molecular Formula | C12H17N3O4 |
| Molecular Weight | 267.28 g/mol |
| Exact Mass | 267.12 |
| IUPAC Name | 2-[3-oxo-1-(pent-3-ynylcarbamoyl)piperazin-2-yl]acetic acid |
| SMILES | CC#CCCNC(=O)N1CCNC(=O)C1CC(=O)O |
| InChI | InChI=1S/C12H17N3O4/c1-2-3-4-5-14-12(19)15-7-6-13-11(18)9(15)8-10(16)17/h9H,4-8H2,1H3,(H,13,18)(H,14,19)(H,16,17) |
| InChIKey | FTAFTSFEVFLORE-UHFFFAOYSA-N |
| XLogP | -0.62 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.28 |
| LogP ≤ 5 | -0.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|