C13H20N2O5 — CID 103555657
2-[1-[2-(1-methoxycyclobutyl)acetyl]-3-oxopiperazin-2-yl]acetic acid (PubChem CID 103555657) has the molecular formula C13H20N2O5 and a molecular weight of 284.31 g/mol. Its IUPAC name is 2-[1-[2-(1-methoxycyclobutyl)acetyl]-3-oxopiperazin-2-yl]acetic acid.
| Compound Name | 2-[1-[2-(1-methoxycyclobutyl)acetyl]-3-oxopiperazin-2-yl]acetic acid |
|---|---|
| PubChem CID | 103555657 |
| Molecular Formula | C13H20N2O5 |
| Molecular Weight | 284.31 g/mol |
| Exact Mass | 284.14 |
| IUPAC Name | 2-[1-[2-(1-methoxycyclobutyl)acetyl]-3-oxopiperazin-2-yl]acetic acid |
| SMILES | COC1(CC(=O)N2CCNC(=O)C2CC(=O)O)CCC1 |
| InChI | InChI=1S/C13H20N2O5/c1-20-13(3-2-4-13)8-10(16)15-6-5-14-12(19)9(15)7-11(17)18/h9H,2-8H2,1H3,(H,14,19)(H,17,18) |
| InChIKey | KSNWDWCCKMTISB-UHFFFAOYSA-N |
| XLogP | -0.25 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.31 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |