C10H17N5O5 — CID 83114279
2-[1-[2-(carbamoylamino)ethylcarbamoyl]-3-oxopiperazin-2-yl]acetic acid (PubChem CID 83114279) has the molecular formula C10H17N5O5 and a molecular weight of 287.28 g/mol. Its IUPAC name is 2-[1-[2-(carbamoylamino)ethylcarbamoyl]-3-oxopiperazin-2-yl]acetic acid.
| Compound Name | 2-[1-[2-(carbamoylamino)ethylcarbamoyl]-3-oxopiperazin-2-yl]acetic acid |
|---|---|
| PubChem CID | 83114279 |
| Molecular Formula | C10H17N5O5 |
| Molecular Weight | 287.28 g/mol |
| Exact Mass | 287.12 |
| IUPAC Name | 2-[1-[2-(carbamoylamino)ethylcarbamoyl]-3-oxopiperazin-2-yl]acetic acid |
| SMILES | NC(=O)NCCNC(=O)N1CCNC(=O)C1CC(=O)O |
| InChI | InChI=1S/C10H17N5O5/c11-9(19)13-1-2-14-10(20)15-4-3-12-8(18)6(15)5-7(16)17/h6H,1-5H2,(H,12,18)(H,14,20)(H,16,17)(H3,11,13,19) |
| InChIKey | RBUQBBQXSSJPEZ-UHFFFAOYSA-N |
| XLogP | -2.36 |
| TPSA | 153.86 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.28 |
| LogP ≤ 5 | -2.36 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|