C15H19N3O3S — CID 91768233
N-methyl-2-[1-(2-methylsulfanylbenzoyl)-3-oxopiperazin-2-yl]acetamide (PubChem CID 91768233) has the molecular formula C15H19N3O3S and a molecular weight of 321.40 g/mol. Its IUPAC name is N-methyl-2-[1-(2-methylsulfanylbenzoyl)-3-oxopiperazin-2-yl]acetamide.
| Compound Name | N-methyl-2-[1-(2-methylsulfanylbenzoyl)-3-oxopiperazin-2-yl]acetamide |
|---|---|
| PubChem CID | 91768233 |
| Molecular Formula | C15H19N3O3S |
| Molecular Weight | 321.40 g/mol |
| Exact Mass | 321.11 |
| IUPAC Name | N-methyl-2-[1-(2-methylsulfanylbenzoyl)-3-oxopiperazin-2-yl]acetamide |
| SMILES | CNC(=O)CC1C(=O)NCCN1C(=O)c1ccccc1SC |
| InChI | InChI=1S/C15H19N3O3S/c1-16-13(19)9-11-14(20)17-7-8-18(11)15(21)10-5-3-4-6-12(10)22-2/h3-6,11H,7-9H2,1-2H3,(H,16,19)(H,17,20) |
| InChIKey | HCYKVHXRXDEPOT-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.40 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |