C14H14F2N2O4 — CID 3994011
methyl 2-[1-(2,6-difluorobenzoyl)-3-oxopiperazin-2-yl]acetate (PubChem CID 3994011) has the molecular formula C14H14F2N2O4 and a molecular weight of 312.27 g/mol. Its IUPAC name is methyl 2-[1-(2,6-difluorobenzoyl)-3-oxopiperazin-2-yl]acetate.
| Compound Name | methyl 2-[1-(2,6-difluorobenzoyl)-3-oxopiperazin-2-yl]acetate |
|---|---|
| PubChem CID | 3994011 |
| Molecular Formula | C14H14F2N2O4 |
| Molecular Weight | 312.27 g/mol |
| Exact Mass | 312.09 |
| IUPAC Name | methyl 2-[1-(2,6-difluorobenzoyl)-3-oxopiperazin-2-yl]acetate |
| SMILES | COC(=O)CC1C(=O)NCCN1C(=O)c1c(F)cccc1F |
| InChI | InChI=1S/C14H14F2N2O4/c1-22-11(19)7-10-13(20)17-5-6-18(10)14(21)12-8(15)3-2-4-9(12)16/h2-4,10H,5-7H2,1H3,(H,17,20) |
| InChIKey | YBVGHGWAZZTNTF-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.27 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |