C16H17N3O4 — CID 162634981
methyl 2-[1-(indolizine-3-carbonyl)-3-oxopiperazin-2-yl]acetate (PubChem CID 162634981) has the molecular formula C16H17N3O4 and a molecular weight of 315.33 g/mol. Its IUPAC name is methyl 2-[1-(indolizine-3-carbonyl)-3-oxopiperazin-2-yl]acetate.
| Compound Name | methyl 2-[1-(indolizine-3-carbonyl)-3-oxopiperazin-2-yl]acetate |
|---|---|
| PubChem CID | 162634981 |
| Molecular Formula | C16H17N3O4 |
| Molecular Weight | 315.33 g/mol |
| Exact Mass | 315.12 |
| IUPAC Name | methyl 2-[1-(indolizine-3-carbonyl)-3-oxopiperazin-2-yl]acetate |
| SMILES | COC(=O)CC1C(=O)NCCN1C(=O)c1ccc2ccccn12 |
| InChI | InChI=1S/C16H17N3O4/c1-23-14(20)10-13-15(21)17-7-9-19(13)16(22)12-6-5-11-4-2-3-8-18(11)12/h2-6,8,13H,7,9-10H2,1H3,(H,17,21) |
| InChIKey | AUFRNZSYVUDHGP-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 80.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.33 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |