C14H14Cl2N2O4 — CID 2431498
methyl 2-[(2R)-1-(3,5-dichlorobenzoyl)-3-oxopiperazin-2-yl]acetate (PubChem CID 2431498) has the molecular formula C14H14Cl2N2O4 and a molecular weight of 345.18 g/mol. Its IUPAC name is methyl 2-[(2R)-1-(3,5-dichlorobenzoyl)-3-oxopiperazin-2-yl]acetate.
| Compound Name | methyl 2-[(2R)-1-(3,5-dichlorobenzoyl)-3-oxopiperazin-2-yl]acetate |
|---|---|
| PubChem CID | 2431498 |
| Molecular Formula | C14H14Cl2N2O4 |
| Molecular Weight | 345.18 g/mol |
| Exact Mass | 344.03 |
| IUPAC Name | methyl 2-[(2R)-1-(3,5-dichlorobenzoyl)-3-oxopiperazin-2-yl]acetate |
| SMILES | COC(=O)C[C@@H]1C(=O)NCCN1C(=O)c1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C14H14Cl2N2O4/c1-22-12(19)7-11-13(20)17-2-3-18(11)14(21)8-4-9(15)6-10(16)5-8/h4-6,11H,2-3,7H2,1H3,(H,17,20)/t11-/m1/s1 |
| InChIKey | UMTWSIONQMCFJI-LLVKDONJSA-N |
| XLogP | 1.50 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.18 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |