C16H19ClN2O6 — CID 43011903
methyl 2-[1-(3-chloro-4,5-dimethoxybenzoyl)-3-oxopiperazin-2-yl]acetate (PubChem CID 43011903) has the molecular formula C16H19ClN2O6 and a molecular weight of 370.79 g/mol. Its IUPAC name is methyl 2-[1-(3-chloro-4,5-dimethoxybenzoyl)-3-oxopiperazin-2-yl]acetate.
| Compound Name | methyl 2-[1-(3-chloro-4,5-dimethoxybenzoyl)-3-oxopiperazin-2-yl]acetate |
|---|---|
| PubChem CID | 43011903 |
| Molecular Formula | C16H19ClN2O6 |
| Molecular Weight | 370.79 g/mol |
| Exact Mass | 370.09 |
| IUPAC Name | methyl 2-[1-(3-chloro-4,5-dimethoxybenzoyl)-3-oxopiperazin-2-yl]acetate |
| SMILES | COC(=O)CC1C(=O)NCCN1C(=O)c1cc(Cl)c(OC)c(OC)c1 |
| InChI | InChI=1S/C16H19ClN2O6/c1-23-12-7-9(6-10(17)14(12)25-3)16(22)19-5-4-18-15(21)11(19)8-13(20)24-2/h6-7,11H,4-5,8H2,1-3H3,(H,18,21) |
| InChIKey | RMKBKZXOIUXJPP-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.79 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |