C15H17ClN2O5 — CID 2919627
methyl 2-[1-[2-(4-chlorophenoxy)acetyl]-3-oxopiperazin-2-yl]acetate (PubChem CID 2919627) has the molecular formula C15H17ClN2O5 and a molecular weight of 340.76 g/mol. Its IUPAC name is methyl 2-[1-[2-(4-chlorophenoxy)acetyl]-3-oxopiperazin-2-yl]acetate.
| Compound Name | methyl 2-[1-[2-(4-chlorophenoxy)acetyl]-3-oxopiperazin-2-yl]acetate |
|---|---|
| PubChem CID | 2919627 |
| Molecular Formula | C15H17ClN2O5 |
| Molecular Weight | 340.76 g/mol |
| Exact Mass | 340.08 |
| IUPAC Name | methyl 2-[1-[2-(4-chlorophenoxy)acetyl]-3-oxopiperazin-2-yl]acetate |
| SMILES | COC(=O)CC1C(=O)NCCN1C(=O)COc1ccc(Cl)cc1 |
| InChI | InChI=1S/C15H17ClN2O5/c1-22-14(20)8-12-15(21)17-6-7-18(12)13(19)9-23-11-4-2-10(16)3-5-11/h2-5,12H,6-9H2,1H3,(H,17,21) |
| InChIKey | BLQTURRDKXDNIY-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.76 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |