C24H34N2O5 — CID 4945035
cyclohexyl 2-[1-[2-(4-tert-butylphenoxy)acetyl]-3-oxopiperazin-2-yl]acetate (PubChem CID 4945035) has the molecular formula C24H34N2O5 and a molecular weight of 430.55 g/mol. Its IUPAC name is cyclohexyl 2-[1-[2-(4-tert-butylphenoxy)acetyl]-3-oxopiperazin-2-yl]acetate.
| Compound Name | cyclohexyl 2-[1-[2-(4-tert-butylphenoxy)acetyl]-3-oxopiperazin-2-yl]acetate |
|---|---|
| PubChem CID | 4945035 |
| Molecular Formula | C24H34N2O5 |
| Molecular Weight | 430.55 g/mol |
| Exact Mass | 430.25 |
| IUPAC Name | cyclohexyl 2-[1-[2-(4-tert-butylphenoxy)acetyl]-3-oxopiperazin-2-yl]acetate |
| SMILES | CC(C)(C)c1ccc(OCC(=O)N2CCNC(=O)C2CC(=O)OC2CCCCC2)cc1 |
| InChI | InChI=1S/C24H34N2O5/c1-24(2,3)17-9-11-18(12-10-17)30-16-21(27)26-14-13-25-23(29)20(26)15-22(28)31-19-7-5-4-6-8-19/h9-12,19-20H,4-8,13-16H2,1-3H3,(H,25,29) |
| InChIKey | QMUMUTDYBRBPPO-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.55 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |