C27H34N2O6 — CID 17093272
2-phenoxyethyl 2-[1-[2-[4-(2-methylbutan-2-yl)phenoxy]acetyl]-3-oxopiperazin-2-yl]acetate (PubChem CID 17093272) has the molecular formula C27H34N2O6 and a molecular weight of 482.58 g/mol. Its IUPAC name is 2-phenoxyethyl 2-[1-[2-[4-(2-methylbutan-2-yl)phenoxy]acetyl]-3-oxopiperazin-2-yl]acetate.
| Compound Name | 2-phenoxyethyl 2-[1-[2-[4-(2-methylbutan-2-yl)phenoxy]acetyl]-3-oxopiperazin-2-yl]acetate |
|---|---|
| PubChem CID | 17093272 |
| Molecular Formula | C27H34N2O6 |
| Molecular Weight | 482.58 g/mol |
| Exact Mass | 482.24 |
| IUPAC Name | 2-phenoxyethyl 2-[1-[2-[4-(2-methylbutan-2-yl)phenoxy]acetyl]-3-oxopiperazin-2-yl]acetate |
| SMILES | CCC(C)(C)c1ccc(OCC(=O)N2CCNC(=O)C2CC(=O)OCCOc2ccccc2)cc1 |
| InChI | InChI=1S/C27H34N2O6/c1-4-27(2,3)20-10-12-22(13-11-20)35-19-24(30)29-15-14-28-26(32)23(29)18-25(31)34-17-16-33-21-8-6-5-7-9-21/h5-13,23H,4,14-19H2,1-3H3,(H,28,32) |
| InChIKey | SOFSHGKUIPKUPB-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.58 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|