C20H26N4O6 — CID 54794777
2-phenoxyethyl 2-[3-oxo-1-[2-(3-oxopiperazin-2-yl)acetyl]piperazin-2-yl]acetate (PubChem CID 54794777) has the molecular formula C20H26N4O6 and a molecular weight of 418.45 g/mol. Its IUPAC name is 2-phenoxyethyl 2-[3-oxo-1-[2-(3-oxopiperazin-2-yl)acetyl]piperazin-2-yl]acetate.
| Compound Name | 2-phenoxyethyl 2-[3-oxo-1-[2-(3-oxopiperazin-2-yl)acetyl]piperazin-2-yl]acetate |
|---|---|
| PubChem CID | 54794777 |
| Molecular Formula | C20H26N4O6 |
| Molecular Weight | 418.45 g/mol |
| Exact Mass | 418.19 |
| IUPAC Name | 2-phenoxyethyl 2-[3-oxo-1-[2-(3-oxopiperazin-2-yl)acetyl]piperazin-2-yl]acetate |
| SMILES | O=C(CC1C(=O)NCCN1C(=O)CC1NCCNC1=O)OCCOc1ccccc1 |
| InChI | InChI=1S/C20H26N4O6/c25-17(12-15-19(27)22-7-6-21-15)24-9-8-23-20(28)16(24)13-18(26)30-11-10-29-14-4-2-1-3-5-14/h1-5,15-16,21H,6-13H2,(H,22,27)(H,23,28) |
| InChIKey | QKJYKRHCIHOFRE-UHFFFAOYSA-N |
| XLogP | -1.20 |
| TPSA | 126.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.45 |
| LogP ≤ 5 | -1.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|