C19H25N3O8S — CID 2422730
methyl 2-[(2R)-1-(4-methoxy-3-morpholin-4-ylsulfonylbenzoyl)-3-oxopiperazin-2-yl]acetate (PubChem CID 2422730) has the molecular formula C19H25N3O8S and a molecular weight of 455.49 g/mol. Its IUPAC name is methyl 2-[(2R)-1-(4-methoxy-3-morpholin-4-ylsulfonylbenzoyl)-3-oxopiperazin-2-yl]acetate.
| Compound Name | methyl 2-[(2R)-1-(4-methoxy-3-morpholin-4-ylsulfonylbenzoyl)-3-oxopiperazin-2-yl]acetate |
|---|---|
| PubChem CID | 2422730 |
| Molecular Formula | C19H25N3O8S |
| Molecular Weight | 455.49 g/mol |
| Exact Mass | 455.14 |
| IUPAC Name | methyl 2-[(2R)-1-(4-methoxy-3-morpholin-4-ylsulfonylbenzoyl)-3-oxopiperazin-2-yl]acetate |
| SMILES | COC(=O)C[C@@H]1C(=O)NCCN1C(=O)c1ccc(OC)c(S(=O)(=O)N2CCOCC2)c1 |
| InChI | InChI=1S/C19H25N3O8S/c1-28-15-4-3-13(11-16(15)31(26,27)21-7-9-30-10-8-21)19(25)22-6-5-20-18(24)14(22)12-17(23)29-2/h3-4,11,14H,5-10,12H2,1-2H3,(H,20,24)/t14-/m1/s1 |
| InChIKey | ITINWZCUHKAIEU-CQSZACIVSA-N |
| XLogP | -0.78 |
| TPSA | 131.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.49 |
| LogP ≤ 5 | -0.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |