C12H20N2O5 — CID 2986153
tert-butyl 2-(2-methoxy-2-oxoethyl)-3-oxopiperazine-1-carboxylate (PubChem CID 2986153) has the molecular formula C12H20N2O5 and a molecular weight of 272.30 g/mol. Its IUPAC name is tert-butyl 2-(2-methoxy-2-oxoethyl)-3-oxopiperazine-1-carboxylate.
| Compound Name | tert-butyl 2-(2-methoxy-2-oxoethyl)-3-oxopiperazine-1-carboxylate |
|---|---|
| PubChem CID | 2986153 |
| Molecular Formula | C12H20N2O5 |
| Molecular Weight | 272.30 g/mol |
| Exact Mass | 272.14 |
| IUPAC Name | tert-butyl 2-(2-methoxy-2-oxoethyl)-3-oxopiperazine-1-carboxylate |
| SMILES | COC(=O)CC1C(=O)NCCN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C12H20N2O5/c1-12(2,3)19-11(17)14-6-5-13-10(16)8(14)7-9(15)18-4/h8H,5-7H2,1-4H3,(H,13,16) |
| InChIKey | IEIGHVVRJBQGSY-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.30 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |