C13H18N2O4 — CID 43074138
methyl 2-[1-[(2E,4E)-hexa-2,4-dienoyl]-3-oxopiperazin-2-yl]acetate (PubChem CID 43074138) has the molecular formula C13H18N2O4 and a molecular weight of 266.30 g/mol. Its IUPAC name is methyl 2-[1-[(2E,4E)-hexa-2,4-dienoyl]-3-oxopiperazin-2-yl]acetate.
| Compound Name | methyl 2-[1-[(2E,4E)-hexa-2,4-dienoyl]-3-oxopiperazin-2-yl]acetate |
|---|---|
| PubChem CID | 43074138 |
| Molecular Formula | C13H18N2O4 |
| Molecular Weight | 266.30 g/mol |
| Exact Mass | 266.13 |
| IUPAC Name | methyl 2-[1-[(2E,4E)-hexa-2,4-dienoyl]-3-oxopiperazin-2-yl]acetate |
| SMILES | C/C=C/C=C/C(=O)N1CCNC(=O)C1CC(=O)OC |
| InChI | InChI=1S/C13H18N2O4/c1-3-4-5-6-11(16)15-8-7-14-13(18)10(15)9-12(17)19-2/h3-6,10H,7-9H2,1-2H3,(H,14,18)/b4-3+,6-5+ |
| InChIKey | HDRXAYJCAHNPGH-VNKDHWASSA-N |
| XLogP | 0.01 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.30 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|