C16H20N4O6 — CID 43074106
methyl 2-[1-[(E)-3-(1,3-dimethyl-2,4-dioxopyrimidin-5-yl)prop-2-enoyl]-3-oxopiperazin-2-yl]acetate (PubChem CID 43074106) has the molecular formula C16H20N4O6 and a molecular weight of 364.36 g/mol. Its IUPAC name is methyl 2-[1-[(E)-3-(1,3-dimethyl-2,4-dioxopyrimidin-5-yl)prop-2-enoyl]-3-oxopiperazin-2-yl]acetate.
| Compound Name | methyl 2-[1-[(E)-3-(1,3-dimethyl-2,4-dioxopyrimidin-5-yl)prop-2-enoyl]-3-oxopiperazin-2-yl]acetate |
|---|---|
| PubChem CID | 43074106 |
| Molecular Formula | C16H20N4O6 |
| Molecular Weight | 364.36 g/mol |
| Exact Mass | 364.14 |
| IUPAC Name | methyl 2-[1-[(E)-3-(1,3-dimethyl-2,4-dioxopyrimidin-5-yl)prop-2-enoyl]-3-oxopiperazin-2-yl]acetate |
| SMILES | COC(=O)CC1C(=O)NCCN1C(=O)/C=C/c1cn(C)c(=O)n(C)c1=O |
| InChI | InChI=1S/C16H20N4O6/c1-18-9-10(15(24)19(2)16(18)25)4-5-12(21)20-7-6-17-14(23)11(20)8-13(22)26-3/h4-5,9,11H,6-8H2,1-3H3,(H,17,23)/b5-4+ |
| InChIKey | DZHDLIUGVBAEMP-SNAWJCMRSA-N |
| XLogP | -2.01 |
| TPSA | 119.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.36 |
| LogP ≤ 5 | -2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|