C22H36N2O6 — CID 17093833
ethyl (E)-4-[2-(2-decoxy-2-oxoethyl)-3-oxopiperazin-1-yl]-4-oxobut-2-enoate (PubChem CID 17093833) has the molecular formula C22H36N2O6 and a molecular weight of 424.54 g/mol. Its IUPAC name is ethyl (E)-4-[2-(2-decoxy-2-oxoethyl)-3-oxopiperazin-1-yl]-4-oxobut-2-enoate.
| Compound Name | ethyl (E)-4-[2-(2-decoxy-2-oxoethyl)-3-oxopiperazin-1-yl]-4-oxobut-2-enoate |
|---|---|
| PubChem CID | 17093833 |
| Molecular Formula | C22H36N2O6 |
| Molecular Weight | 424.54 g/mol |
| Exact Mass | 424.26 |
| IUPAC Name | ethyl (E)-4-[2-(2-decoxy-2-oxoethyl)-3-oxopiperazin-1-yl]-4-oxobut-2-enoate |
| SMILES | CCCCCCCCCCOC(=O)CC1C(=O)NCCN1C(=O)/C=C/C(=O)OCC |
| InChI | InChI=1S/C22H36N2O6/c1-3-5-6-7-8-9-10-11-16-30-21(27)17-18-22(28)23-14-15-24(18)19(25)12-13-20(26)29-4-2/h12-13,18H,3-11,14-17H2,1-2H3,(H,23,28)/b13-12+ |
| InChIKey | OMQSFBLFRUQUHV-OUKQBFOZSA-N |
| XLogP | 2.51 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.54 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|