C17H16ClF3N2O4 — CID 43011914
methyl 2-[1-[(E)-3-[4-chloro-3-(trifluoromethyl)phenyl]prop-2-enoyl]-3-oxopiperazin-2-yl]acetate (PubChem CID 43011914) has the molecular formula C17H16ClF3N2O4 and a molecular weight of 404.77 g/mol. Its IUPAC name is methyl 2-[1-[(E)-3-[4-chloro-3-(trifluoromethyl)phenyl]prop-2-enoyl]-3-oxopiperazin-2-yl]acetate.
| Compound Name | methyl 2-[1-[(E)-3-[4-chloro-3-(trifluoromethyl)phenyl]prop-2-enoyl]-3-oxopiperazin-2-yl]acetate |
|---|---|
| PubChem CID | 43011914 |
| Molecular Formula | C17H16ClF3N2O4 |
| Molecular Weight | 404.77 g/mol |
| Exact Mass | 404.08 |
| IUPAC Name | methyl 2-[1-[(E)-3-[4-chloro-3-(trifluoromethyl)phenyl]prop-2-enoyl]-3-oxopiperazin-2-yl]acetate |
| SMILES | COC(=O)CC1C(=O)NCCN1C(=O)/C=C/c1ccc(Cl)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C17H16ClF3N2O4/c1-27-15(25)9-13-16(26)22-6-7-23(13)14(24)5-3-10-2-4-12(18)11(8-10)17(19,20)21/h2-5,8,13H,6-7,9H2,1H3,(H,22,26)/b5-3+ |
| InChIKey | MECIYGXHETYZDH-HWKANZROSA-N |
| XLogP | 2.26 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.77 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|