C23H23ClN2O4 — CID 17195483
2-phenylethyl 2-[1-[(E)-3-(4-chlorophenyl)prop-2-enoyl]-3-oxopiperazin-2-yl]acetate (PubChem CID 17195483) has the molecular formula C23H23ClN2O4 and a molecular weight of 426.90 g/mol. Its IUPAC name is 2-phenylethyl 2-[1-[(E)-3-(4-chlorophenyl)prop-2-enoyl]-3-oxopiperazin-2-yl]acetate.
| Compound Name | 2-phenylethyl 2-[1-[(E)-3-(4-chlorophenyl)prop-2-enoyl]-3-oxopiperazin-2-yl]acetate |
|---|---|
| PubChem CID | 17195483 |
| Molecular Formula | C23H23ClN2O4 |
| Molecular Weight | 426.90 g/mol |
| Exact Mass | 426.13 |
| IUPAC Name | 2-phenylethyl 2-[1-[(E)-3-(4-chlorophenyl)prop-2-enoyl]-3-oxopiperazin-2-yl]acetate |
| SMILES | O=C(CC1C(=O)NCCN1C(=O)/C=C/c1ccc(Cl)cc1)OCCc1ccccc1 |
| InChI | InChI=1S/C23H23ClN2O4/c24-19-9-6-18(7-10-19)8-11-21(27)26-14-13-25-23(29)20(26)16-22(28)30-15-12-17-4-2-1-3-5-17/h1-11,20H,12-16H2,(H,25,29)/b11-8+ |
| InChIKey | VLVMRNUOCKDHTR-DHZHZOJOSA-N |
| XLogP | 2.86 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.90 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|