C17H17N3O5 — CID 43074080
methyl 2-[1-[(E)-3-(1,3-benzoxazol-2-yl)prop-2-enoyl]-3-oxopiperazin-2-yl]acetate (PubChem CID 43074080) has the molecular formula C17H17N3O5 and a molecular weight of 343.34 g/mol. Its IUPAC name is methyl 2-[1-[(E)-3-(1,3-benzoxazol-2-yl)prop-2-enoyl]-3-oxopiperazin-2-yl]acetate.
| Compound Name | methyl 2-[1-[(E)-3-(1,3-benzoxazol-2-yl)prop-2-enoyl]-3-oxopiperazin-2-yl]acetate |
|---|---|
| PubChem CID | 43074080 |
| Molecular Formula | C17H17N3O5 |
| Molecular Weight | 343.34 g/mol |
| Exact Mass | 343.12 |
| IUPAC Name | methyl 2-[1-[(E)-3-(1,3-benzoxazol-2-yl)prop-2-enoyl]-3-oxopiperazin-2-yl]acetate |
| SMILES | COC(=O)CC1C(=O)NCCN1C(=O)/C=C/c1nc2ccccc2o1 |
| InChI | InChI=1S/C17H17N3O5/c1-24-16(22)10-12-17(23)18-8-9-20(12)15(21)7-6-14-19-11-4-2-3-5-13(11)25-14/h2-7,12H,8-10H2,1H3,(H,18,23)/b7-6+ |
| InChIKey | ZIYSLMYGENEIIZ-VOTSOKGWSA-N |
| XLogP | 0.73 |
| TPSA | 101.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.34 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|