C18H20N4O3 — CID 97449878
1,3-dimethyl-5-[(Z)-3-oxo-3-[(2R)-2-pyridin-4-ylpyrrolidin-1-yl]prop-1-enyl]pyrimidine-2,4-dione (PubChem CID 97449878) has the molecular formula C18H20N4O3 and a molecular weight of 340.38 g/mol. Its IUPAC name is 1,3-dimethyl-5-[(Z)-3-oxo-3-[(2R)-2-pyridin-4-ylpyrrolidin-1-yl]prop-1-enyl]pyrimidine-2,4-dione.
| Compound Name | 1,3-dimethyl-5-[(Z)-3-oxo-3-[(2R)-2-pyridin-4-ylpyrrolidin-1-yl]prop-1-enyl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 97449878 |
| Molecular Formula | C18H20N4O3 |
| Molecular Weight | 340.38 g/mol |
| Exact Mass | 340.15 |
| IUPAC Name | 1,3-dimethyl-5-[(Z)-3-oxo-3-[(2R)-2-pyridin-4-ylpyrrolidin-1-yl]prop-1-enyl]pyrimidine-2,4-dione |
| SMILES | Cn1cc(/C=C\C(=O)N2CCC[C@@H]2c2ccncc2)c(=O)n(C)c1=O |
| InChI | InChI=1S/C18H20N4O3/c1-20-12-14(17(24)21(2)18(20)25)5-6-16(23)22-11-3-4-15(22)13-7-9-19-10-8-13/h5-10,12,15H,3-4,11H2,1-2H3/b6-5-/t15-/m1/s1 |
| InChIKey | VKJOAGQCKUMYSC-IYKSTZQJSA-N |
| XLogP | 0.86 |
| TPSA | 77.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.38 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|