C14H24N2O5 — CID 3161315
tert-butyl 3-oxo-2-(2-oxo-2-propoxyethyl)piperazine-1-carboxylate (PubChem CID 3161315) has the molecular formula C14H24N2O5 and a molecular weight of 300.36 g/mol. Its IUPAC name is tert-butyl 3-oxo-2-(2-oxo-2-propoxyethyl)piperazine-1-carboxylate.
| Compound Name | tert-butyl 3-oxo-2-(2-oxo-2-propoxyethyl)piperazine-1-carboxylate |
|---|---|
| PubChem CID | 3161315 |
| Molecular Formula | C14H24N2O5 |
| Molecular Weight | 300.36 g/mol |
| Exact Mass | 300.17 |
| IUPAC Name | tert-butyl 3-oxo-2-(2-oxo-2-propoxyethyl)piperazine-1-carboxylate |
| SMILES | CCCOC(=O)CC1C(=O)NCCN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C14H24N2O5/c1-5-8-20-11(17)9-10-12(18)15-6-7-16(10)13(19)21-14(2,3)4/h10H,5-9H2,1-4H3,(H,15,18) |
| InChIKey | JTFJCGPHFHPQMS-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.36 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |