C20H20FN3O4 — CID 121496108
2-[1-[3-(2-fluoro-4-hydroxyphenyl)benzoyl]-3-oxopiperazin-2-yl]-N-methylacetamide (PubChem CID 121496108) has the molecular formula C20H20FN3O4 and a molecular weight of 385.40 g/mol. Its IUPAC name is 2-[1-[3-(2-fluoro-4-hydroxyphenyl)benzoyl]-3-oxopiperazin-2-yl]-N-methylacetamide.
| Compound Name | 2-[1-[3-(2-fluoro-4-hydroxyphenyl)benzoyl]-3-oxopiperazin-2-yl]-N-methylacetamide |
|---|---|
| PubChem CID | 121496108 |
| Molecular Formula | C20H20FN3O4 |
| Molecular Weight | 385.40 g/mol |
| Exact Mass | 385.14 |
| IUPAC Name | 2-[1-[3-(2-fluoro-4-hydroxyphenyl)benzoyl]-3-oxopiperazin-2-yl]-N-methylacetamide |
| SMILES | CNC(=O)CC1C(=O)NCCN1C(=O)c1cccc(-c2ccc(O)cc2F)c1 |
| InChI | InChI=1S/C20H20FN3O4/c1-22-18(26)11-17-19(27)23-7-8-24(17)20(28)13-4-2-3-12(9-13)15-6-5-14(25)10-16(15)21/h2-6,9-10,17,25H,7-8,11H2,1H3,(H,22,26)(H,23,27) |
| InChIKey | YCOHSAXQXBXLQP-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.40 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |