C19H23FN4O3 — CID 126445021
(2S)-N-[3-(3,5-dimethyl-1,2-oxazol-4-yl)propyl]-2-(4-fluorophenyl)-3-oxopiperazine-1-carboxamide (PubChem CID 126445021) has the molecular formula C19H23FN4O3 and a molecular weight of 374.42 g/mol. Its IUPAC name is (2S)-N-[3-(3,5-dimethyl-1,2-oxazol-4-yl)propyl]-2-(4-fluorophenyl)-3-oxopiperazine-1-carboxamide.
| Compound Name | (2S)-N-[3-(3,5-dimethyl-1,2-oxazol-4-yl)propyl]-2-(4-fluorophenyl)-3-oxopiperazine-1-carboxamide |
|---|---|
| PubChem CID | 126445021 |
| Molecular Formula | C19H23FN4O3 |
| Molecular Weight | 374.42 g/mol |
| Exact Mass | 374.18 |
| IUPAC Name | (2S)-N-[3-(3,5-dimethyl-1,2-oxazol-4-yl)propyl]-2-(4-fluorophenyl)-3-oxopiperazine-1-carboxamide |
| SMILES | Cc1noc(C)c1CCCNC(=O)N1CCNC(=O)[C@@H]1c1ccc(F)cc1 |
| InChI | InChI=1S/C19H23FN4O3/c1-12-16(13(2)27-23-12)4-3-9-22-19(26)24-11-10-21-18(25)17(24)14-5-7-15(20)8-6-14/h5-8,17H,3-4,9-11H2,1-2H3,(H,21,25)(H,22,26)/t17-/m0/s1 |
| InChIKey | FUKYMKLLNWWZTR-KRWDZBQOSA-N |
| XLogP | 2.25 |
| TPSA | 87.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.42 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|