C17H29N3O2 — CID 97240756
(3R,5R)-N-[3-(3,5-dimethyl-1,2-oxazol-4-yl)propyl]-3,5-dimethylazepane-1-carboxamide (PubChem CID 97240756) has the molecular formula C17H29N3O2 and a molecular weight of 307.44 g/mol. Its IUPAC name is (3R,5R)-N-[3-(3,5-dimethyl-1,2-oxazol-4-yl)propyl]-3,5-dimethylazepane-1-carboxamide.
| Compound Name | (3R,5R)-N-[3-(3,5-dimethyl-1,2-oxazol-4-yl)propyl]-3,5-dimethylazepane-1-carboxamide |
|---|---|
| PubChem CID | 97240756 |
| Molecular Formula | C17H29N3O2 |
| Molecular Weight | 307.44 g/mol |
| Exact Mass | 307.23 |
| IUPAC Name | (3R,5R)-N-[3-(3,5-dimethyl-1,2-oxazol-4-yl)propyl]-3,5-dimethylazepane-1-carboxamide |
| SMILES | Cc1noc(C)c1CCCNC(=O)N1CC[C@H](C)C[C@@H](C)C1 |
| InChI | InChI=1S/C17H29N3O2/c1-12-7-9-20(11-13(2)10-12)17(21)18-8-5-6-16-14(3)19-22-15(16)4/h12-13H,5-11H2,1-4H3,(H,18,21)/t12-,13+/m0/s1 |
| InChIKey | YVCIXZQXJLMJNZ-QWHCGFSZSA-N |
| XLogP | 3.30 |
| TPSA | 58.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.44 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|