C16H20ClN5OS — CID 91786646
3-chloro-N-[2-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanyl]ethyl]-4-pyrrolidin-1-ylbenzamide (PubChem CID 91786646) has the molecular formula C16H20ClN5OS and a molecular weight of 365.89 g/mol. Its IUPAC name is 3-chloro-N-[2-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanyl]ethyl]-4-pyrrolidin-1-ylbenzamide.
| Compound Name | 3-chloro-N-[2-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanyl]ethyl]-4-pyrrolidin-1-ylbenzamide |
|---|---|
| PubChem CID | 91786646 |
| Molecular Formula | C16H20ClN5OS |
| Molecular Weight | 365.89 g/mol |
| Exact Mass | 365.11 |
| IUPAC Name | 3-chloro-N-[2-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanyl]ethyl]-4-pyrrolidin-1-ylbenzamide |
| SMILES | Cc1nc(SCCNC(=O)c2ccc(N3CCCC3)c(Cl)c2)n[nH]1 |
| InChI | InChI=1S/C16H20ClN5OS/c1-11-19-16(21-20-11)24-9-6-18-15(23)12-4-5-14(13(17)10-12)22-7-2-3-8-22/h4-5,10H,2-3,6-9H2,1H3,(H,18,23)(H,19,20,21) |
| InChIKey | OZYIFCWBPZODMQ-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.89 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|