C26H25N5O3S2 — CID 100765873
1-(4-methylphenyl)sulfonyl-N-[2-[(5-phenyl-1H-1,2,4-triazol-3-yl)sulfanyl]ethyl]-2,3-dihydroindole-5-carboxamide (PubChem CID 100765873) has the molecular formula C26H25N5O3S2 and a molecular weight of 519.65 g/mol. Its IUPAC name is 1-(4-methylphenyl)sulfonyl-N-[2-[(5-phenyl-1H-1,2,4-triazol-3-yl)sulfanyl]ethyl]-2,3-dihydroindole-5-carboxamide.
| Compound Name | 1-(4-methylphenyl)sulfonyl-N-[2-[(5-phenyl-1H-1,2,4-triazol-3-yl)sulfanyl]ethyl]-2,3-dihydroindole-5-carboxamide |
|---|---|
| PubChem CID | 100765873 |
| Molecular Formula | C26H25N5O3S2 |
| Molecular Weight | 519.65 g/mol |
| Exact Mass | 519.14 |
| IUPAC Name | 1-(4-methylphenyl)sulfonyl-N-[2-[(5-phenyl-1H-1,2,4-triazol-3-yl)sulfanyl]ethyl]-2,3-dihydroindole-5-carboxamide |
| SMILES | Cc1ccc(S(=O)(=O)N2CCc3cc(C(=O)NCCSc4n[nH]c(-c5ccccc5)n4)ccc32)cc1 |
| InChI | InChI=1S/C26H25N5O3S2/c1-18-7-10-22(11-8-18)36(33,34)31-15-13-20-17-21(9-12-23(20)31)25(32)27-14-16-35-26-28-24(29-30-26)19-5-3-2-4-6-19/h2-12,17H,13-16H2,1H3,(H,27,32)(H,28,29,30) |
| InChIKey | AWMBEKIYJAYQHU-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 108.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.65 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|