C23H26N2O3S — CID 23608824
1-(benzenesulfonyl)-N-[2-(cyclohexen-1-yl)ethyl]-2,3-dihydroindole-5-carboxamide (PubChem CID 23608824) has the molecular formula C23H26N2O3S and a molecular weight of 410.54 g/mol. Its IUPAC name is 1-(benzenesulfonyl)-N-[2-(cyclohexen-1-yl)ethyl]-2,3-dihydroindole-5-carboxamide.
| Compound Name | 1-(benzenesulfonyl)-N-[2-(cyclohexen-1-yl)ethyl]-2,3-dihydroindole-5-carboxamide |
|---|---|
| PubChem CID | 23608824 |
| Molecular Formula | C23H26N2O3S |
| Molecular Weight | 410.54 g/mol |
| Exact Mass | 410.17 |
| IUPAC Name | 1-(benzenesulfonyl)-N-[2-(cyclohexen-1-yl)ethyl]-2,3-dihydroindole-5-carboxamide |
| SMILES | O=C(NCCC1=CCCCC1)c1ccc2c(c1)CCN2S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C23H26N2O3S/c26-23(24-15-13-18-7-3-1-4-8-18)20-11-12-22-19(17-20)14-16-25(22)29(27,28)21-9-5-2-6-10-21/h2,5-7,9-12,17H,1,3-4,8,13-16H2,(H,24,26) |
| InChIKey | UKYNEVODGQJSHT-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.54 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|