C21H24N4O — CID 109251077
N-[2-(cyclohexen-1-yl)ethyl]-2-(2,3-dihydroindol-1-yl)pyrimidine-5-carboxamide (PubChem CID 109251077) has the molecular formula C21H24N4O and a molecular weight of 348.45 g/mol. Its IUPAC name is N-[2-(cyclohexen-1-yl)ethyl]-2-(2,3-dihydroindol-1-yl)pyrimidine-5-carboxamide.
| Compound Name | N-[2-(cyclohexen-1-yl)ethyl]-2-(2,3-dihydroindol-1-yl)pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 109251077 |
| Molecular Formula | C21H24N4O |
| Molecular Weight | 348.45 g/mol |
| Exact Mass | 348.20 |
| IUPAC Name | N-[2-(cyclohexen-1-yl)ethyl]-2-(2,3-dihydroindol-1-yl)pyrimidine-5-carboxamide |
| SMILES | O=C(NCCC1=CCCCC1)c1cnc(N2CCc3ccccc32)nc1 |
| InChI | InChI=1S/C21H24N4O/c26-20(22-12-10-16-6-2-1-3-7-16)18-14-23-21(24-15-18)25-13-11-17-8-4-5-9-19(17)25/h4-6,8-9,14-15H,1-3,7,10-13H2,(H,22,26) |
| InChIKey | RPPBKSLBQNNNRG-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.45 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|