C19H18ClN5O3S2 — CID 100765315
1-(4-chlorophenyl)sulfonyl-N-[2-(1H-1,2,4-triazol-5-ylsulfanyl)ethyl]-2,3-dihydroindole-5-carboxamide (PubChem CID 100765315) has the molecular formula C19H18ClN5O3S2 and a molecular weight of 463.97 g/mol. Its IUPAC name is 1-(4-chlorophenyl)sulfonyl-N-[2-(1H-1,2,4-triazol-5-ylsulfanyl)ethyl]-2,3-dihydroindole-5-carboxamide.
| Compound Name | 1-(4-chlorophenyl)sulfonyl-N-[2-(1H-1,2,4-triazol-5-ylsulfanyl)ethyl]-2,3-dihydroindole-5-carboxamide |
|---|---|
| PubChem CID | 100765315 |
| Molecular Formula | C19H18ClN5O3S2 |
| Molecular Weight | 463.97 g/mol |
| Exact Mass | 463.05 |
| IUPAC Name | 1-(4-chlorophenyl)sulfonyl-N-[2-(1H-1,2,4-triazol-5-ylsulfanyl)ethyl]-2,3-dihydroindole-5-carboxamide |
| SMILES | O=C(NCCSc1ncn[nH]1)c1ccc2c(c1)CCN2S(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C19H18ClN5O3S2/c20-15-2-4-16(5-3-15)30(27,28)25-9-7-13-11-14(1-6-17(13)25)18(26)21-8-10-29-19-22-12-23-24-19/h1-6,11-12H,7-10H2,(H,21,26)(H,22,23,24) |
| InChIKey | PYJLCIZTOVWQTA-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 108.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.97 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|