C12H13FN4O2S — CID 131929584
4-fluoro-3-methoxy-N-[2-(1H-1,2,4-triazol-5-ylsulfanyl)ethyl]benzamide (PubChem CID 131929584) has the molecular formula C12H13FN4O2S and a molecular weight of 296.33 g/mol. Its IUPAC name is 4-fluoro-3-methoxy-N-[2-(1H-1,2,4-triazol-5-ylsulfanyl)ethyl]benzamide.
| Compound Name | 4-fluoro-3-methoxy-N-[2-(1H-1,2,4-triazol-5-ylsulfanyl)ethyl]benzamide |
|---|---|
| PubChem CID | 131929584 |
| Molecular Formula | C12H13FN4O2S |
| Molecular Weight | 296.33 g/mol |
| Exact Mass | 296.07 |
| IUPAC Name | 4-fluoro-3-methoxy-N-[2-(1H-1,2,4-triazol-5-ylsulfanyl)ethyl]benzamide |
| SMILES | COc1cc(C(=O)NCCSc2ncn[nH]2)ccc1F |
| InChI | InChI=1S/C12H13FN4O2S/c1-19-10-6-8(2-3-9(10)13)11(18)14-4-5-20-12-15-7-16-17-12/h2-3,6-7H,4-5H2,1H3,(H,14,18)(H,15,16,17) |
| InChIKey | NLQGBBNUROMZAS-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.33 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|