C14H16N6OS — CID 56722867
5-methyl-N-[2-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanyl]ethyl]-1H-indazole-3-carboxamide (PubChem CID 56722867) has the molecular formula C14H16N6OS and a molecular weight of 316.39 g/mol. Its IUPAC name is 5-methyl-N-[2-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanyl]ethyl]-1H-indazole-3-carboxamide.
| Compound Name | 5-methyl-N-[2-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanyl]ethyl]-1H-indazole-3-carboxamide |
|---|---|
| PubChem CID | 56722867 |
| Molecular Formula | C14H16N6OS |
| Molecular Weight | 316.39 g/mol |
| Exact Mass | 316.11 |
| IUPAC Name | 5-methyl-N-[2-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanyl]ethyl]-1H-indazole-3-carboxamide |
| SMILES | Cc1ccc2[nH]nc(C(=O)NCCSc3n[nH]c(C)n3)c2c1 |
| InChI | InChI=1S/C14H16N6OS/c1-8-3-4-11-10(7-8)12(19-18-11)13(21)15-5-6-22-14-16-9(2)17-20-14/h3-4,7H,5-6H2,1-2H3,(H,15,21)(H,18,19)(H,16,17,20) |
| InChIKey | APTXHXMZFPOPBL-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 99.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.39 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|