C17H26N4O — CID 78859037
N-[2-[di(propan-2-yl)amino]ethyl]-5-methyl-1H-indazole-3-carboxamide (PubChem CID 78859037) has the molecular formula C17H26N4O and a molecular weight of 302.42 g/mol. Its IUPAC name is N-[2-[di(propan-2-yl)amino]ethyl]-5-methyl-1H-indazole-3-carboxamide.
| Compound Name | N-[2-[di(propan-2-yl)amino]ethyl]-5-methyl-1H-indazole-3-carboxamide |
|---|---|
| PubChem CID | 78859037 |
| Molecular Formula | C17H26N4O |
| Molecular Weight | 302.42 g/mol |
| Exact Mass | 302.21 |
| IUPAC Name | N-[2-[di(propan-2-yl)amino]ethyl]-5-methyl-1H-indazole-3-carboxamide |
| SMILES | Cc1ccc2[nH]nc(C(=O)NCCN(C(C)C)C(C)C)c2c1 |
| InChI | InChI=1S/C17H26N4O/c1-11(2)21(12(3)4)9-8-18-17(22)16-14-10-13(5)6-7-15(14)19-20-16/h6-7,10-12H,8-9H2,1-5H3,(H,18,22)(H,19,20) |
| InChIKey | NOVVVMRROIJCFJ-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 61.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.42 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |