C3H5BF3KN4S — CID 63704198
potassium (5-amino-1H-1,2,4-triazol-3-yl)sulfanylmethyl-trifluoroboranuide (PubChem CID 63704198) has the molecular formula C3H5BF3KN4S and a molecular weight of 236.07 g/mol. Its IUPAC name is potassium (5-amino-1H-1,2,4-triazol-3-yl)sulfanylmethyl-trifluoroboranuide.
| Compound Name | potassium (5-amino-1H-1,2,4-triazol-3-yl)sulfanylmethyl-trifluoroboranuide |
|---|---|
| PubChem CID | 63704198 |
| Molecular Formula | C3H5BF3KN4S |
| Molecular Weight | 236.07 g/mol |
| Exact Mass | 235.99 |
| IUPAC Name | potassium (5-amino-1H-1,2,4-triazol-3-yl)sulfanylmethyl-trifluoroboranuide |
| SMILES | Nc1nc(SC[B-](F)(F)F)n[nH]1.[K+] |
| InChI | InChI=1S/C3H5BF3N4S.K/c5-4(6,7)1-12-3-9-2(8)10-11-3;/h1H2,(H3,8,9,10,11);/q-1;+1 |
| InChIKey | GFKKDGRVSNHWOJ-UHFFFAOYSA-N |
| XLogP | -2.13 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.07 |
| LogP ≤ 5 | -2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|