C8H14N8OS2 — CID 6917260
3-[2-[2-[(5-amino-1H-1,2,4-triazol-3-yl)sulfanyl]ethoxy]ethylsulfanyl]-1H-1,2,4-triazol-5-amine (PubChem CID 6917260) has the molecular formula C8H14N8OS2 and a molecular weight of 302.39 g/mol. Its IUPAC name is 3-[2-[2-[(5-amino-1H-1,2,4-triazol-3-yl)sulfanyl]ethoxy]ethylsulfanyl]-1H-1,2,4-triazol-5-amine.
| Compound Name | 3-[2-[2-[(5-amino-1H-1,2,4-triazol-3-yl)sulfanyl]ethoxy]ethylsulfanyl]-1H-1,2,4-triazol-5-amine |
|---|---|
| PubChem CID | 6917260 |
| Molecular Formula | C8H14N8OS2 |
| Molecular Weight | 302.39 g/mol |
| Exact Mass | 302.07 |
| IUPAC Name | 3-[2-[2-[(5-amino-1H-1,2,4-triazol-3-yl)sulfanyl]ethoxy]ethylsulfanyl]-1H-1,2,4-triazol-5-amine |
| SMILES | Nc1nc(SCCOCCSc2n[nH]c(N)n2)n[nH]1 |
| InChI | InChI=1S/C8H14N8OS2/c9-5-11-7(15-13-5)18-3-1-17-2-4-19-8-12-6(10)14-16-8/h1-4H2,(H3,9,11,13,15)(H3,10,12,14,16) |
| InChIKey | RXCVITIERPJZFV-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 144.41 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.39 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|