C12H13N5O2S — CID 122141849
4-[2-[(5-amino-1H-1,2,4-triazol-3-yl)sulfanyl]ethoxy]-3-methoxybenzonitrile (PubChem CID 122141849) has the molecular formula C12H13N5O2S and a molecular weight of 291.34 g/mol. Its IUPAC name is 4-[2-[(5-amino-1H-1,2,4-triazol-3-yl)sulfanyl]ethoxy]-3-methoxybenzonitrile.
| Compound Name | 4-[2-[(5-amino-1H-1,2,4-triazol-3-yl)sulfanyl]ethoxy]-3-methoxybenzonitrile |
|---|---|
| PubChem CID | 122141849 |
| Molecular Formula | C12H13N5O2S |
| Molecular Weight | 291.34 g/mol |
| Exact Mass | 291.08 |
| IUPAC Name | 4-[2-[(5-amino-1H-1,2,4-triazol-3-yl)sulfanyl]ethoxy]-3-methoxybenzonitrile |
| SMILES | COc1cc(C#N)ccc1OCCSc1n[nH]c(N)n1 |
| InChI | InChI=1S/C12H13N5O2S/c1-18-10-6-8(7-13)2-3-9(10)19-4-5-20-12-15-11(14)16-17-12/h2-3,6H,4-5H2,1H3,(H3,14,15,16,17) |
| InChIKey | JSKPDHSAKKRWDM-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 109.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.34 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|