C9H14N4O2S — CID 77102371
methyl 4-[(5-amino-1H-1,2,4-triazol-3-yl)sulfanyl]-2-ethylbut-2-enoate (PubChem CID 77102371) has the molecular formula C9H14N4O2S and a molecular weight of 242.30 g/mol. Its IUPAC name is methyl 4-[(5-amino-1H-1,2,4-triazol-3-yl)sulfanyl]-2-ethylbut-2-enoate.
| Compound Name | methyl 4-[(5-amino-1H-1,2,4-triazol-3-yl)sulfanyl]-2-ethylbut-2-enoate |
|---|---|
| PubChem CID | 77102371 |
| Molecular Formula | C9H14N4O2S |
| Molecular Weight | 242.30 g/mol |
| Exact Mass | 242.08 |
| IUPAC Name | methyl 4-[(5-amino-1H-1,2,4-triazol-3-yl)sulfanyl]-2-ethylbut-2-enoate |
| SMILES | CCC(=CCSc1n[nH]c(N)n1)C(=O)OC |
| InChI | InChI=1S/C9H14N4O2S/c1-3-6(7(14)15-2)4-5-16-9-11-8(10)12-13-9/h4H,3,5H2,1-2H3,(H3,10,11,12,13) |
| InChIKey | ZFZZDMUZMHXJFV-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 93.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.30 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|