About methyl 4-[(5-amino-1H-1,2,4-triazol-3-yl)sulfanyl]-2-ethylbut-2-enoate
methyl 4-[(5-amino-1H-1,2,4-triazol-3-yl)sulfanyl]-2-ethylbut-2-enoate (PubChem CID 77102371) has the molecular formula C9H14N4O2S
and a molecular weight of 242.30 g/mol. Its IUPAC name is methyl 4-[(5-amino-1H-1,2,4-triazol-3-yl)sulfanyl]-2-ethylbut-2-enoate.
Molecular Properties
| Compound Name | methyl 4-[(5-amino-1H-1,2,4-triazol-3-yl)sulfanyl]-2-ethylbut-2-enoate |
| PubChem CID | 77102371 |
| Molecular Formula | C9H14N4O2S |
| Molecular Weight | 242.30 g/mol |
| Exact Mass | 242.08 |
| IUPAC Name | methyl 4-[(5-amino-1H-1,2,4-triazol-3-yl)sulfanyl]-2-ethylbut-2-enoate |
| SMILES | CCC(=CCSc1n[nH]c(N)n1)C(=O)OC |
| InChI | InChI=1S/C9H14N4O2S/c1-3-6(7(14)15-2)4-5-16-9-11-8(10)12-13-9/h4H,3,5H2,1-2H3,(H3,10,11,12,13) |
| InChIKey | ZFZZDMUZMHXJFV-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 93.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.30 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze methyl 4-[(5-amino-1H-1,2,4-triazol-3-yl)sulfanyl]-2-ethylbut-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-[(5-amino-1H-1,2,4-triazol-3-yl)sulfanyl]-2-ethylbut-2-enoate?
The IUPAC name of methyl 4-[(5-amino-1H-1,2,4-triazol-3-yl)sulfanyl]-2-ethylbut-2-enoate (CID 77102371) is methyl 4-[(5-amino-1H-1,2,4-triazol-3-yl)sulfanyl]-2-ethylbut-2-enoate.
What is the SMILES notation for methyl 4-[(5-amino-1H-1,2,4-triazol-3-yl)sulfanyl]-2-ethylbut-2-enoate?
The canonical SMILES for methyl 4-[(5-amino-1H-1,2,4-triazol-3-yl)sulfanyl]-2-ethylbut-2-enoate is CCC(=CCSc1n[nH]c(N)n1)C(=O)OC.
What is the InChIKey of methyl 4-[(5-amino-1H-1,2,4-triazol-3-yl)sulfanyl]-2-ethylbut-2-enoate?
The InChIKey is ZFZZDMUZMHXJFV-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14N4O2S/c1-3-6(7(14)15-2)4-5-16-9-11-8(10)12-13-9/h4H,3,5H2,1-2H3,(H3,10,11,12,13).
What are the key properties of methyl 4-[(5-amino-1H-1,2,4-triazol-3-yl)sulfanyl]-2-ethylbut-2-enoate?
methyl 4-[(5-amino-1H-1,2,4-triazol-3-yl)sulfanyl]-2-ethylbut-2-enoate has a molecular weight of 242.30 g/mol, XLogP of 0.99, 5 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-[(5-amino-1H-1,2,4-triazol-3-yl)sulfanyl]-2-ethylbut-2-enoate is sourced from PubChem (CID 77102371), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).