C9H17N3O2S — CID 63629618
3-(2,2-diethoxyethylsulfanyl)-5-methyl-1H-1,2,4-triazole (PubChem CID 63629618) has the molecular formula C9H17N3O2S and a molecular weight of 231.32 g/mol. Its IUPAC name is 3-(2,2-diethoxyethylsulfanyl)-5-methyl-1H-1,2,4-triazole.
| Compound Name | 3-(2,2-diethoxyethylsulfanyl)-5-methyl-1H-1,2,4-triazole |
|---|---|
| PubChem CID | 63629618 |
| Molecular Formula | C9H17N3O2S |
| Molecular Weight | 231.32 g/mol |
| Exact Mass | 231.10 |
| IUPAC Name | 3-(2,2-diethoxyethylsulfanyl)-5-methyl-1H-1,2,4-triazole |
| SMILES | CCOC(CSc1n[nH]c(C)n1)OCC |
| InChI | InChI=1S/C9H17N3O2S/c1-4-13-8(14-5-2)6-15-9-10-7(3)11-12-9/h8H,4-6H2,1-3H3,(H,10,11,12) |
| InChIKey | MPVZLLDMZYBAFO-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.32 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|