C7H13N5OS — CID 63591170
2-methyl-3-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanyl]propanehydrazide (PubChem CID 63591170) has the molecular formula C7H13N5OS and a molecular weight of 215.28 g/mol. Its IUPAC name is 2-methyl-3-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanyl]propanehydrazide.
| Compound Name | 2-methyl-3-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanyl]propanehydrazide |
|---|---|
| PubChem CID | 63591170 |
| Molecular Formula | C7H13N5OS |
| Molecular Weight | 215.28 g/mol |
| Exact Mass | 215.08 |
| IUPAC Name | 2-methyl-3-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanyl]propanehydrazide |
| SMILES | Cc1nc(SCC(C)C(=O)NN)n[nH]1 |
| InChI | InChI=1S/C7H13N5OS/c1-4(6(13)10-8)3-14-7-9-5(2)11-12-7/h4H,3,8H2,1-2H3,(H,10,13)(H,9,11,12) |
| InChIKey | PNYDKUOZRYCJBW-UHFFFAOYSA-N |
| XLogP | -0.17 |
| TPSA | 96.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.28 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|