C15H27N3OS — CID 65041027
2-butoxy-N-[2-(4,5,6-trimethylpyrimidin-2-yl)sulfanylethyl]ethanamine (PubChem CID 65041027) has the molecular formula C15H27N3OS and a molecular weight of 297.47 g/mol. Its IUPAC name is 2-butoxy-N-[2-(4,5,6-trimethylpyrimidin-2-yl)sulfanylethyl]ethanamine.
| Compound Name | 2-butoxy-N-[2-(4,5,6-trimethylpyrimidin-2-yl)sulfanylethyl]ethanamine |
|---|---|
| PubChem CID | 65041027 |
| Molecular Formula | C15H27N3OS |
| Molecular Weight | 297.47 g/mol |
| Exact Mass | 297.19 |
| IUPAC Name | 2-butoxy-N-[2-(4,5,6-trimethylpyrimidin-2-yl)sulfanylethyl]ethanamine |
| SMILES | CCCCOCCNCCSc1nc(C)c(C)c(C)n1 |
| InChI | InChI=1S/C15H27N3OS/c1-5-6-9-19-10-7-16-8-11-20-15-17-13(3)12(2)14(4)18-15/h16H,5-11H2,1-4H3 |
| InChIKey | ZLSDSQPSUPYPSK-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.47 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|