C12H22N2OS — CID 64539322
2-butoxy-N-[(2,4-dimethyl-1,3-thiazol-5-yl)methyl]ethanamine (PubChem CID 64539322) has the molecular formula C12H22N2OS and a molecular weight of 242.39 g/mol. Its IUPAC name is 2-butoxy-N-[(2,4-dimethyl-1,3-thiazol-5-yl)methyl]ethanamine.
| Compound Name | 2-butoxy-N-[(2,4-dimethyl-1,3-thiazol-5-yl)methyl]ethanamine |
|---|---|
| PubChem CID | 64539322 |
| Molecular Formula | C12H22N2OS |
| Molecular Weight | 242.39 g/mol |
| Exact Mass | 242.15 |
| IUPAC Name | 2-butoxy-N-[(2,4-dimethyl-1,3-thiazol-5-yl)methyl]ethanamine |
| SMILES | CCCCOCCNCc1sc(C)nc1C |
| InChI | InChI=1S/C12H22N2OS/c1-4-5-7-15-8-6-13-9-12-10(2)14-11(3)16-12/h13H,4-9H2,1-3H3 |
| InChIKey | YHDBKYYVMAVVDH-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.39 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|