C10H18N2S2 — CID 64540795
N-[(2,4-dimethyl-1,3-thiazol-5-yl)methyl]-3-methylsulfanylpropan-1-amine (PubChem CID 64540795) has the molecular formula C10H18N2S2 and a molecular weight of 230.40 g/mol. Its IUPAC name is N-[(2,4-dimethyl-1,3-thiazol-5-yl)methyl]-3-methylsulfanylpropan-1-amine.
| Compound Name | N-[(2,4-dimethyl-1,3-thiazol-5-yl)methyl]-3-methylsulfanylpropan-1-amine |
|---|---|
| PubChem CID | 64540795 |
| Molecular Formula | C10H18N2S2 |
| Molecular Weight | 230.40 g/mol |
| Exact Mass | 230.09 |
| IUPAC Name | N-[(2,4-dimethyl-1,3-thiazol-5-yl)methyl]-3-methylsulfanylpropan-1-amine |
| SMILES | CSCCCNCc1sc(C)nc1C |
| InChI | InChI=1S/C10H18N2S2/c1-8-10(14-9(2)12-8)7-11-5-4-6-13-3/h11H,4-7H2,1-3H3 |
| InChIKey | ZORQNSOMEAJZSR-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.40 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|